C14H20N4O2 — CID 56953586
2-N,3-N-diethyl-6,7-dimethoxyquinoxaline-2,3-diamine (PubChem CID 56953586) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-N,3-N-diethyl-6,7-dimethoxyquinoxaline-2,3-diamine.
| Compound Name | 2-N,3-N-diethyl-6,7-dimethoxyquinoxaline-2,3-diamine |
|---|---|
| PubChem CID | 56953586 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-N,3-N-diethyl-6,7-dimethoxyquinoxaline-2,3-diamine |
| SMILES | CCNc1nc2cc(OC)c(OC)cc2nc1NCC |
| InChI | InChI=1S/C14H20N4O2/c1-5-15-13-14(16-6-2)18-10-8-12(20-4)11(19-3)7-9(10)17-13/h7-8H,5-6H2,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | QZUBRJHMIXSERC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |