C21H22F3N — CID 56953948
(3aR,6S,6aS)-6a-methyl-6-phenyl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrole (PubChem CID 56953948) has the molecular formula C21H22F3N and a molecular weight of 345.41 g/mol. Its IUPAC name is (3aR,6S,6aS)-6a-methyl-6-phenyl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrole.
| Compound Name | (3aR,6S,6aS)-6a-methyl-6-phenyl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 56953948 |
| Molecular Formula | C21H22F3N |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (3aR,6S,6aS)-6a-methyl-6-phenyl-1-[4-(trifluoromethyl)phenyl]-2,3,3a,4,5,6-hexahydrocyclopenta[b]pyrrole |
| SMILES | C[C@]12[C@H](CC[C@H]1c1ccccc1)CCN2c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3N/c1-20-16(9-12-19(20)15-5-3-2-4-6-15)13-14-25(20)18-10-7-17(8-11-18)21(22,23)24/h2-8,10-11,16,19H,9,12-14H2,1H3/t16-,19+,20+/m1/s1 |
| InChIKey | FVOBRSGPDPOKPC-UXPWSPDFSA-N |
| XLogP | 5.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |