C22H36N10O2S2 — CID 56954129
N,N'-bis[N'-[3-(2-amino-1,3-thiazol-5-yl)propyl]carbamimidoyl]octanediamide (PubChem CID 56954129) has the molecular formula C22H36N10O2S2 and a molecular weight of 536.73 g/mol. Its IUPAC name is N,N'-bis[N'-[3-(2-amino-1,3-thiazol-5-yl)propyl]carbamimidoyl]octanediamide.
| Compound Name | N,N'-bis[N'-[3-(2-amino-1,3-thiazol-5-yl)propyl]carbamimidoyl]octanediamide |
|---|---|
| PubChem CID | 56954129 |
| Molecular Formula | C22H36N10O2S2 |
| Molecular Weight | 536.73 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | N,N'-bis[N'-[3-(2-amino-1,3-thiazol-5-yl)propyl]carbamimidoyl]octanediamide |
| SMILES | N/C(=N\CCCc1cnc(N)s1)NC(=O)CCCCCCC(=O)N/C(N)=N/CCCc1cnc(N)s1 |
| InChI | InChI=1S/C22H36N10O2S2/c23-19(27-11-5-7-15-13-29-21(25)35-15)31-17(33)9-3-1-2-4-10-18(34)32-20(24)28-12-6-8-16-14-30-22(26)36-16/h13-14H,1-12H2,(H2,25,29)(H2,26,30)(H3,23,27,31,33)(H3,24,28,32,34) |
| InChIKey | RKSXQJRAAANUNM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 212.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|