C24H40N10O2S2 — CID 56954227
N,N'-bis[N'-[3-(2-amino-1,3-thiazol-5-yl)propyl]carbamimidoyl]decanediamide (PubChem CID 56954227) has the molecular formula C24H40N10O2S2 and a molecular weight of 564.79 g/mol. Its IUPAC name is N,N'-bis[N'-[3-(2-amino-1,3-thiazol-5-yl)propyl]carbamimidoyl]decanediamide.
| Compound Name | N,N'-bis[N'-[3-(2-amino-1,3-thiazol-5-yl)propyl]carbamimidoyl]decanediamide |
|---|---|
| PubChem CID | 56954227 |
| Molecular Formula | C24H40N10O2S2 |
| Molecular Weight | 564.79 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | N,N'-bis[N'-[3-(2-amino-1,3-thiazol-5-yl)propyl]carbamimidoyl]decanediamide |
| SMILES | N/C(=N\CCCc1cnc(N)s1)NC(=O)CCCCCCCCC(=O)N/C(N)=N/CCCc1cnc(N)s1 |
| InChI | InChI=1S/C24H40N10O2S2/c25-21(29-13-7-9-17-15-31-23(27)37-17)33-19(35)11-5-3-1-2-4-6-12-20(36)34-22(26)30-14-8-10-18-16-32-24(28)38-18/h15-16H,1-14H2,(H2,27,31)(H2,28,32)(H3,25,29,33,35)(H3,26,30,34,36) |
| InChIKey | MLVBVDKCQYPOBL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 212.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.79 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|