About 3-benzoylazepan-2-one
3-benzoylazepan-2-one (PubChem CID 569544) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-benzoylazepan-2-one.
Molecular Properties
| Compound Name | 3-benzoylazepan-2-one |
| PubChem CID | 569544 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-benzoylazepan-2-one |
| SMILES | O=C1NCCCCC1C(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO2/c15-12(10-6-2-1-3-7-10)11-8-4-5-9-14-13(11)16/h1-3,6-7,11H,4-5,8-9H2,(H,14,16) |
| InChIKey | FAGGUIDTQQXDSJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoylazepan-2-one?
The IUPAC name of 3-benzoylazepan-2-one (CID 569544) is 3-benzoylazepan-2-one.
What is the SMILES notation for 3-benzoylazepan-2-one?
The canonical SMILES for 3-benzoylazepan-2-one is O=C1NCCCCC1C(=O)c1ccccc1.
What is the InChIKey of 3-benzoylazepan-2-one?
The InChIKey is FAGGUIDTQQXDSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c15-12(10-6-2-1-3-7-10)11-8-4-5-9-14-13(11)16/h1-3,6-7,11H,4-5,8-9H2,(H,14,16).
What are the key properties of 3-benzoylazepan-2-one?
3-benzoylazepan-2-one has a molecular weight of 217.27 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoylazepan-2-one is sourced from PubChem (CID 569544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).