About 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde
2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde (PubChem CID 56954480) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde.
Molecular Properties
| Compound Name | 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde |
| PubChem CID | 56954480 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde |
| SMILES | O=CC(c1ccccc1)[C@@H]1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C16H20O3/c17-12-15(13-5-2-1-3-6-13)14-7-4-8-16(11-14)18-9-10-19-16/h1-3,5-6,12,14-15H,4,7-11H2/t14-,15?/m1/s1 |
| InChIKey | OIOPYOWOWQCDBO-GICMACPYSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde?
The IUPAC name of 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde (CID 56954480) is 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde.
What is the SMILES notation for 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde?
The canonical SMILES for 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde is O=CC(c1ccccc1)[C@@H]1CCCC2(C1)OCCO2.
What is the InChIKey of 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde?
The InChIKey is OIOPYOWOWQCDBO-GICMACPYSA-N. The full InChI is InChI=1S/C16H20O3/c17-12-15(13-5-2-1-3-6-13)14-7-4-8-16(11-14)18-9-10-19-16/h1-3,5-6,12,14-15H,4,7-11H2/t14-,15?/m1/s1.
What are the key properties of 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde?
2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde has a molecular weight of 260.33 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7R)-1,4-dioxaspiro[4.5]decan-7-yl]-2-phenylacetaldehyde is sourced from PubChem (CID 56954480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).