About 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea
1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea (PubChem CID 56954622) has the molecular formula C28H24N4O4
and a molecular weight of 480.52 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea.
Molecular Properties
| Compound Name | 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea |
| PubChem CID | 56954622 |
| Molecular Formula | C28H24N4O4 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea |
| SMILES | COc1cc2ncnc(Oc3ccc(NC(=O)Nc4ccc5ccccc5c4)c(C)c3)c2cc1OC |
| InChI | InChI=1S/C28H24N4O4/c1-17-12-21(36-27-22-14-25(34-2)26(35-3)15-24(22)29-16-30-27)10-11-23(17)32-28(33)31-20-9-8-18-6-4-5-7-19(18)13-20/h4-16H,1-3H3,(H2,31,32,33) |
| InChIKey | OORYJASUHYXOOK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea?
The IUPAC name of 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea (CID 56954622) is 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea.
What is the SMILES notation for 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea?
The canonical SMILES for 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea is COc1cc2ncnc(Oc3ccc(NC(=O)Nc4ccc5ccccc5c4)c(C)c3)c2cc1OC.
What is the InChIKey of 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea?
The InChIKey is OORYJASUHYXOOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N4O4/c1-17-12-21(36-27-22-14-25(34-2)26(35-3)15-24(22)29-16-30-27)10-11-23(17)32-28(33)31-20-9-8-18-6-4-5-7-19(18)13-20/h4-16H,1-3H3,(H2,31,32,33).
What are the key properties of 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea?
1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea has a molecular weight of 480.52 g/mol, XLogP of 6.54, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(6,7-dimethoxyquinazolin-4-yl)oxy-2-methylphenyl]-3-naphthalen-2-ylurea is sourced from PubChem (CID 56954622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).