C24H28N2O3 — CID 56954660
propan-2-yl (17S)-17-acetyl-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaene-17-carboxylate (PubChem CID 56954660) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is propan-2-yl (17S)-17-acetyl-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaene-17-carboxylate.
| Compound Name | propan-2-yl (17S)-17-acetyl-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaene-17-carboxylate |
|---|---|
| PubChem CID | 56954660 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | propan-2-yl (17S)-17-acetyl-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaene-17-carboxylate |
| SMILES | CC(=O)[C@]1(C(=O)OC(C)C)CN2Cc3cc(C)ccc3N1Cc1cc(C)ccc12 |
| InChI | InChI=1S/C24H28N2O3/c1-15(2)29-23(28)24(18(5)27)14-25-12-19-10-17(4)7-9-22(19)26(24)13-20-11-16(3)6-8-21(20)25/h6-11,15H,12-14H2,1-5H3/t24-/m0/s1 |
| InChIKey | FUEAJQFPRMUYFS-DEOSSOPVSA-N |
| XLogP | 3.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|