About 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine
1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine (PubChem CID 56954731) has the molecular formula C22H24N6O2
and a molecular weight of 404.47 g/mol. Its IUPAC name is 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine.
Molecular Properties
| Compound Name | 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine |
| PubChem CID | 56954731 |
| Molecular Formula | C22H24N6O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(N)nc3ccc([N+](=O)[O-])cc3c2n1Cc1ccc(CN)cc1 |
| InChI | InChI=1S/C22H24N6O2/c1-2-3-4-19-26-20-21(27(19)13-15-7-5-14(12-23)6-8-15)17-11-16(28(29)30)9-10-18(17)25-22(20)24/h5-11H,2-4,12-13,23H2,1H3,(H2,24,25) |
| InChIKey | KWSGZZPRRPCJET-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine?
The IUPAC name of 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine (CID 56954731) is 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine.
What is the SMILES notation for 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine?
The canonical SMILES for 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine is CCCCc1nc2c(N)nc3ccc([N+](=O)[O-])cc3c2n1Cc1ccc(CN)cc1.
What is the InChIKey of 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine?
The InChIKey is KWSGZZPRRPCJET-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N6O2/c1-2-3-4-19-26-20-21(27(19)13-15-7-5-14(12-23)6-8-15)17-11-16(28(29)30)9-10-18(17)25-22(20)24/h5-11H,2-4,12-13,23H2,1H3,(H2,24,25).
What are the key properties of 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine?
1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine has a molecular weight of 404.47 g/mol, XLogP of 3.92, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(aminomethyl)phenyl]methyl]-2-butyl-8-nitroimidazo[4,5-c]quinolin-4-amine is sourced from PubChem (CID 56954731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).