C26H25ClN2O — CID 56954742
1-[(17R)-17-(4-chlorophenyl)-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaen-17-yl]ethanone (PubChem CID 56954742) has the molecular formula C26H25ClN2O and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-[(17R)-17-(4-chlorophenyl)-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaen-17-yl]ethanone.
| Compound Name | 1-[(17R)-17-(4-chlorophenyl)-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaen-17-yl]ethanone |
|---|---|
| PubChem CID | 56954742 |
| Molecular Formula | C26H25ClN2O |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[(17R)-17-(4-chlorophenyl)-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaen-17-yl]ethanone |
| SMILES | CC(=O)[C@@]1(c2ccc(Cl)cc2)CN2Cc3cc(C)ccc3N1Cc1cc(C)ccc12 |
| InChI | InChI=1S/C26H25ClN2O/c1-17-4-10-24-21(13-17)15-29-25-11-5-18(2)12-20(25)14-28(24)16-26(29,19(3)30)22-6-8-23(27)9-7-22/h4-13H,14-16H2,1-3H3/t26-/m1/s1 |
| InChIKey | LKTDVZCUZPQNTK-AREMUKBSSA-N |
| XLogP | 5.78 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |