C23H26N2O3 — CID 56954746
ethyl (17R)-17-acetyl-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaene-17-carboxylate (PubChem CID 56954746) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl (17R)-17-acetyl-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaene-17-carboxylate.
| Compound Name | ethyl (17R)-17-acetyl-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaene-17-carboxylate |
|---|---|
| PubChem CID | 56954746 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | ethyl (17R)-17-acetyl-5,13-dimethyl-1,9-diazatetracyclo[7.7.2.02,7.010,15]octadeca-2(7),3,5,10(15),11,13-hexaene-17-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(C)=O)CN2Cc3cc(C)ccc3N1Cc1cc(C)ccc12 |
| InChI | InChI=1S/C23H26N2O3/c1-5-28-22(27)23(17(4)26)14-24-12-18-10-16(3)7-9-21(18)25(23)13-19-11-15(2)6-8-20(19)24/h6-11H,5,12-14H2,1-4H3/t23-/m1/s1 |
| InChIKey | CUECASJORSIAQM-HSZRJFAPSA-N |
| XLogP | 3.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|