C31H34N6O4 — CID 56954885
(2R,8R)-2-(3,4-dimethoxyphenyl)-6-[(3R)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 56954885) has the molecular formula C31H34N6O4 and a molecular weight of 554.65 g/mol. Its IUPAC name is (2R,8R)-2-(3,4-dimethoxyphenyl)-6-[(3R)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(3,4-dimethoxyphenyl)-6-[(3R)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 56954885 |
| Molecular Formula | C31H34N6O4 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | (2R,8R)-2-(3,4-dimethoxyphenyl)-6-[(3R)-1-[(1-methylimidazol-2-yl)methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc([C@@H]2c3[nH]c4ccccc4c3C[C@@H]3C(=O)N([C@@H]4CCN(Cc5nccn5C)C4)CC(=O)N23)cc1OC |
| InChI | InChI=1S/C31H34N6O4/c1-34-13-11-32-27(34)17-35-12-10-20(16-35)36-18-28(38)37-24(31(36)39)15-22-21-6-4-5-7-23(21)33-29(22)30(37)19-8-9-25(40-2)26(14-19)41-3/h4-9,11,13-14,20,24,30,33H,10,12,15-18H2,1-3H3/t20-,24-,30-/m1/s1 |
| InChIKey | NBXLYPVPGFKRFS-YMLOERMTSA-N |
| XLogP | 2.88 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|