C33H30N4O6 — CID 56954978
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 56954978) has the molecular formula C33H30N4O6 and a molecular weight of 578.63 g/mol. Its IUPAC name is (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 56954978 |
| Molecular Formula | C33H30N4O6 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-(1,3-benzodioxol-5-ylmethyl)pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1[C@H]2Cc3c([nH]c4ccccc34)[C@@H](c3ccc4c(c3)OCO4)N2C(=O)CN1[C@@H]1CCN(Cc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C33H30N4O6/c38-30-16-36(21-9-10-35(15-21)14-19-5-7-26-28(11-19)42-17-40-26)33(39)25-13-23-22-3-1-2-4-24(22)34-31(23)32(37(25)30)20-6-8-27-29(12-20)43-18-41-27/h1-8,11-12,21,25,32,34H,9-10,13-18H2/t21-,25-,32-/m1/s1 |
| InChIKey | SUZCPGPQKAJVFM-NZERDHAXSA-N |
| XLogP | 3.58 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|