C33H32N4O5 — CID 56954979
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 56954979) has the molecular formula C33H32N4O5 and a molecular weight of 564.64 g/mol. Its IUPAC name is (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 56954979 |
| Molecular Formula | C33H32N4O5 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-[(4-methoxyphenyl)methyl]pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | COc1ccc(CN2CC[C@@H](N3CC(=O)N4[C@H](c5ccc6c(c5)OCO6)c5[nH]c6ccccc6c5C[C@@H]4C3=O)C2)cc1 |
| InChI | InChI=1S/C33H32N4O5/c1-40-23-9-6-20(7-10-23)16-35-13-12-22(17-35)36-18-30(38)37-27(33(36)39)15-25-24-4-2-3-5-26(24)34-31(25)32(37)21-8-11-28-29(14-21)42-19-41-28/h2-11,14,22,27,32,34H,12-13,15-19H2,1H3/t22-,27-,32-/m1/s1 |
| InChIKey | MIUDXXHDQZQODC-ZGJWRPMSSA-N |
| XLogP | 3.86 |
| TPSA | 87.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|