C31H29N5O4 — CID 56955085
(2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 56955085) has the molecular formula C31H29N5O4 and a molecular weight of 535.60 g/mol. Its IUPAC name is (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 56955085 |
| Molecular Formula | C31H29N5O4 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-6-[(3R)-1-(pyridin-2-ylmethyl)pyrrolidin-3-yl]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1[C@H]2Cc3c([nH]c4ccccc34)[C@@H](c3ccc4c(c3)OCO4)N2C(=O)CN1[C@@H]1CCN(Cc2ccccn2)C1 |
| InChI | InChI=1S/C31H29N5O4/c37-28-17-35(21-10-12-34(16-21)15-20-5-3-4-11-32-20)31(38)25-14-23-22-6-1-2-7-24(22)33-29(23)30(36(25)28)19-8-9-26-27(13-19)40-18-39-26/h1-9,11,13,21,25,30,33H,10,12,14-18H2/t21-,25-,30-/m1/s1 |
| InChIKey | ANDFVHKJKQGFLR-WIISGGPLSA-N |
| XLogP | 3.25 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|