C35H43Cl2N3O5 — CID 56955202
N-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide;hydrochloride (PubChem CID 56955202) has the molecular formula C35H43Cl2N3O5 and a molecular weight of 656.65 g/mol. Its IUPAC name is N-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide;hydrochloride.
| Compound Name | N-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 56955202 |
| Molecular Formula | C35H43Cl2N3O5 |
| Molecular Weight | 656.65 g/mol |
| Exact Mass | 655.26 |
| IUPAC Name | N-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide;hydrochloride |
| SMILES | COc1cc(OC)c2c(=O)cc(C(=O)NCCCCCCCCCCNc3c4c(nc5cc(Cl)ccc35)CCCC4)oc2c1.Cl |
| InChI | InChI=1S/C35H42ClN3O5.ClH/c1-42-24-20-30(43-2)33-29(40)22-32(44-31(33)21-24)35(41)38-18-12-8-6-4-3-5-7-11-17-37-34-25-13-9-10-14-27(25)39-28-19-23(36)15-16-26(28)34;/h15-16,19-22H,3-14,17-18H2,1-2H3,(H,37,39)(H,38,41);1H |
| InChIKey | RICIIYBGYBBNDN-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.65 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|