C30H28N8O2 — CID 56955289
(2R,8R)-6-[(3R)-1-benzylpyrrolidin-3-yl]-2-(tetrazolo[1,5-a]pyridin-6-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 56955289) has the molecular formula C30H28N8O2 and a molecular weight of 532.61 g/mol. Its IUPAC name is (2R,8R)-6-[(3R)-1-benzylpyrrolidin-3-yl]-2-(tetrazolo[1,5-a]pyridin-6-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (2R,8R)-6-[(3R)-1-benzylpyrrolidin-3-yl]-2-(tetrazolo[1,5-a]pyridin-6-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 56955289 |
| Molecular Formula | C30H28N8O2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (2R,8R)-6-[(3R)-1-benzylpyrrolidin-3-yl]-2-(tetrazolo[1,5-a]pyridin-6-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1[C@H]2Cc3c([nH]c4ccccc34)[C@@H](c3ccc4nnnn4c3)N2C(=O)CN1[C@@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C30H28N8O2/c39-27-18-36(21-12-13-35(17-21)15-19-6-2-1-3-7-19)30(40)25-14-23-22-8-4-5-9-24(22)31-28(23)29(38(25)27)20-10-11-26-32-33-34-37(26)16-20/h1-11,16,21,25,29,31H,12-15,17-18H2/t21-,25-,29-/m1/s1 |
| InChIKey | UKNKCYGLXUUOFT-PRNYMFJNSA-N |
| XLogP | 2.57 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|