C35H44ClN3O5 — CID 56955295
6,7-dimethoxy-4-oxo-N-[10-(1,2,3,4-tetrahydroacridin-9-ylamino)decyl]chromene-2-carboxamide;hydrochloride (PubChem CID 56955295) has the molecular formula C35H44ClN3O5 and a molecular weight of 622.21 g/mol. Its IUPAC name is 6,7-dimethoxy-4-oxo-N-[10-(1,2,3,4-tetrahydroacridin-9-ylamino)decyl]chromene-2-carboxamide;hydrochloride.
| Compound Name | 6,7-dimethoxy-4-oxo-N-[10-(1,2,3,4-tetrahydroacridin-9-ylamino)decyl]chromene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 56955295 |
| Molecular Formula | C35H44ClN3O5 |
| Molecular Weight | 622.21 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | 6,7-dimethoxy-4-oxo-N-[10-(1,2,3,4-tetrahydroacridin-9-ylamino)decyl]chromene-2-carboxamide;hydrochloride |
| SMILES | COc1cc2oc(C(=O)NCCCCCCCCCCNc3c4c(nc5ccccc35)CCCC4)cc(=O)c2cc1OC.Cl |
| InChI | InChI=1S/C35H43N3O5.ClH/c1-41-31-21-26-29(39)22-33(43-30(26)23-32(31)42-2)35(40)37-20-14-8-6-4-3-5-7-13-19-36-34-24-15-9-11-17-27(24)38-28-18-12-10-16-25(28)34;/h9,11,15,17,21-23H,3-8,10,12-14,16,18-20H2,1-2H3,(H,36,38)(H,37,40);1H |
| InChIKey | RFQVXAFXUKLVRK-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.21 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|