C15H10Br2N2O — CID 56955719
(1E,4E)-1,5-bis(4-bromo-2-pyridinyl)penta-1,4-dien-3-one (PubChem CID 56955719) has the molecular formula C15H10Br2N2O and a molecular weight of 394.07 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(4-bromo-2-pyridinyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(4-bromo-2-pyridinyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 56955719 |
| Molecular Formula | C15H10Br2N2O |
| Molecular Weight | 394.07 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | (1E,4E)-1,5-bis(4-bromo-2-pyridinyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1cc(Br)ccn1)/C=C/c1cc(Br)ccn1 |
| InChI | InChI=1S/C15H10Br2N2O/c16-11-5-7-18-13(9-11)1-3-15(20)4-2-14-10-12(17)6-8-19-14/h1-10H/b3-1+,4-2+ |
| InChIKey | XYLDZSXKUNMEAA-ZPUQHVIOSA-N |
| XLogP | 4.30 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.07 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|