About N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide
N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide (PubChem CID 56955980) has the molecular formula C22H34N2O2
and a molecular weight of 358.53 g/mol. Its IUPAC name is N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 56955980 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(c1cc(C2CCCCC2)on1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H34N2O2/c25-22(20-16-21(26-23-20)17-10-4-1-5-11-17)24(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h16-19H,1-15H2 |
| InChIKey | KULQLZKQQHKTID-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide (CID 56955980) is N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide is O=C(c1cc(C2CCCCC2)on1)N(C1CCCCC1)C1CCCCC1.
What is the InChIKey of N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide?
The InChIKey is KULQLZKQQHKTID-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N2O2/c25-22(20-16-21(26-23-20)17-10-4-1-5-11-17)24(18-12-6-2-7-13-18)19-14-8-3-9-15-19/h16-19H,1-15H2.
What are the key properties of N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide?
N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide has a molecular weight of 358.53 g/mol, XLogP of 5.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,5-tricyclohexyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 56955980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).