About 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride
6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride (PubChem CID 56956282) has the molecular formula C13H17Cl2N3OS
and a molecular weight of 334.27 g/mol. Its IUPAC name is 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride |
| PubChem CID | 56956282 |
| Molecular Formula | C13H17Cl2N3OS |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride |
| SMILES | CN(C)CCCn1c(=S)[nH]c2ccc(Cl)cc2c1=O.Cl |
| InChI | InChI=1S/C13H16ClN3OS.ClH/c1-16(2)6-3-7-17-12(18)10-8-9(14)4-5-11(10)15-13(17)19;/h4-5,8H,3,6-7H2,1-2H3,(H,15,19);1H |
| InChIKey | DGVYQMIBXOXZQA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride?
The IUPAC name of 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride (CID 56956282) is 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride.
What is the SMILES notation for 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride?
The canonical SMILES for 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride is CN(C)CCCn1c(=S)[nH]c2ccc(Cl)cc2c1=O.Cl.
What is the InChIKey of 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride?
The InChIKey is DGVYQMIBXOXZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3OS.ClH/c1-16(2)6-3-7-17-12(18)10-8-9(14)4-5-11(10)15-13(17)19;/h4-5,8H,3,6-7H2,1-2H3,(H,15,19);1H.
What are the key properties of 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride?
6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride has a molecular weight of 334.27 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[3-(dimethylamino)propyl]-2-sulfanylidene-1H-quinazolin-4-one;hydrochloride is sourced from PubChem (CID 56956282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).