C20H36O4Si — CID 56956398
ethyl (3aS,4R,6S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a,4-dimethyl-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate (PubChem CID 56956398) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is ethyl (3aS,4R,6S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a,4-dimethyl-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate.
| Compound Name | ethyl (3aS,4R,6S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a,4-dimethyl-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 56956398 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | ethyl (3aS,4R,6S,7aR)-6-[tert-butyl(dimethyl)silyl]oxy-3a,4-dimethyl-3-oxo-2,4,5,6,7,7a-hexahydro-1H-indene-2-carboxylate |
| SMILES | CCOC(=O)C1C[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](C)[C@]2(C)C1=O |
| InChI | InChI=1S/C20H36O4Si/c1-9-23-18(22)16-12-14-11-15(24-25(7,8)19(3,4)5)10-13(2)20(14,6)17(16)21/h13-16H,9-12H2,1-8H3/t13-,14+,15+,16?,20+/m1/s1 |
| InChIKey | COXDZLJCAZNTLG-OVMUQZBFSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|