C21H21Cl3N4O4 — CID 56956634
[(2S,3R,4S,5S)-5-azido-3,4-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 56956634) has the molecular formula C21H21Cl3N4O4 and a molecular weight of 499.78 g/mol. Its IUPAC name is [(2S,3R,4S,5S)-5-azido-3,4-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2S,3R,4S,5S)-5-azido-3,4-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 56956634 |
| Molecular Formula | C21H21Cl3N4O4 |
| Molecular Weight | 499.78 g/mol |
| Exact Mass | 498.06 |
| IUPAC Name | [(2S,3R,4S,5S)-5-azido-3,4-bis(phenylmethoxy)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H]1OCC(N=[N+]=[N-])[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H21Cl3N4O4/c22-21(23,24)20(25)32-19-18(30-12-15-9-5-2-6-10-15)17(16(13-31-19)27-28-26)29-11-14-7-3-1-4-8-14/h1-10,16-19,25H,11-13H2/b25-20+/t16?,17-,18+,19-/m0/s1 |
| InChIKey | WWRRURUKUXBBOA-MKEUSLJQSA-N |
| XLogP | 5.56 |
| TPSA | 109.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|