C35H32N8O3 — CID 56956677
(2R,3S,5R)-5-[4-amino-3-[6-[1-(pyren-1-ylmethyl)triazol-4-yl]hex-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 56956677) has the molecular formula C35H32N8O3 and a molecular weight of 612.69 g/mol. Its IUPAC name is (2R,3S,5R)-5-[4-amino-3-[6-[1-(pyren-1-ylmethyl)triazol-4-yl]hex-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[4-amino-3-[6-[1-(pyren-1-ylmethyl)triazol-4-yl]hex-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 56956677 |
| Molecular Formula | C35H32N8O3 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | (2R,3S,5R)-5-[4-amino-3-[6-[1-(pyren-1-ylmethyl)triazol-4-yl]hex-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1c(C#CCCCCc1cn(Cc3ccc4ccc5cccc6ccc3c4c56)nn1)nn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C35H32N8O3/c36-34-33-27(40-43(35(33)38-20-37-34)30-16-28(45)29(19-44)46-30)9-4-2-1-3-8-25-18-42(41-39-25)17-24-13-12-23-11-10-21-6-5-7-22-14-15-26(24)32(23)31(21)22/h5-7,10-15,18,20,28-30,44-45H,1-3,8,16-17,19H2,(H2,36,37,38)/t28-,29+,30+/m0/s1 |
| InChIKey | YRTLHBMFVGHCMP-FRXPANAUSA-N |
| XLogP | 4.35 |
| TPSA | 150.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|