C16H14F3NO — CID 56956756
N-[(R)-phenyl-[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 56956756) has the molecular formula C16H14F3NO and a molecular weight of 293.29 g/mol. Its IUPAC name is N-[(R)-phenyl-[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | N-[(R)-phenyl-[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 56956756 |
| Molecular Formula | C16H14F3NO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | N-[(R)-phenyl-[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | CC(=O)N[C@H](c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3NO/c1-11(21)20-15(12-5-3-2-4-6-12)13-7-9-14(10-8-13)16(17,18)19/h2-10,15H,1H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | KTOMHAUESSOZMR-OAHLLOKOSA-N |
| XLogP | 3.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |