C20H14N2O3 — CID 56957308
16,17-dimethoxy-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1,3,5,7,9,11,14,16,18-nonaen-20-one (PubChem CID 56957308) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 16,17-dimethoxy-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1,3,5,7,9,11,14,16,18-nonaen-20-one.
| Compound Name | 16,17-dimethoxy-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1,3,5,7,9,11,14,16,18-nonaen-20-one |
|---|---|
| PubChem CID | 56957308 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 16,17-dimethoxy-3,13-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1,3,5,7,9,11,14,16,18-nonaen-20-one |
| SMILES | COc1cc2c(cc1OC)-n1ccc3c4ccccc4nc-3c1C2=O |
| InChI | InChI=1S/C20H14N2O3/c1-24-16-9-13-15(10-17(16)25-2)22-8-7-12-11-5-3-4-6-14(11)21-18(12)19(22)20(13)23/h3-10H,1-2H3 |
| InChIKey | IDSQNJGFTJHZSH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |