About 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine
2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine (PubChem CID 56957362) has the molecular formula C19H21ClN2O2S
and a molecular weight of 376.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine |
| PubChem CID | 56957362 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine |
| SMILES | CCN(CC)c1c(-c2ccc(Cl)cc2)n(S(C)(=O)=O)c2ccccc12 |
| InChI | InChI=1S/C19H21ClN2O2S/c1-4-21(5-2)19-16-8-6-7-9-17(16)22(25(3,23)24)18(19)14-10-12-15(20)13-11-14/h6-13H,4-5H2,1-3H3 |
| InChIKey | AGXRKSUEEGKBJB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine?
The IUPAC name of 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine (CID 56957362) is 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine.
What is the SMILES notation for 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine?
The canonical SMILES for 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine is CCN(CC)c1c(-c2ccc(Cl)cc2)n(S(C)(=O)=O)c2ccccc12.
What is the InChIKey of 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine?
The InChIKey is AGXRKSUEEGKBJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2O2S/c1-4-21(5-2)19-16-8-6-7-9-17(16)22(25(3,23)24)18(19)14-10-12-15(20)13-11-14/h6-13H,4-5H2,1-3H3.
What are the key properties of 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine?
2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine has a molecular weight of 376.91 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-N,N-diethyl-1-methylsulfonylindol-3-amine is sourced from PubChem (CID 56957362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).