C19H26O2 — CID 56957484
(2R)-2-[2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2,3-dihydropyran-6-one (PubChem CID 56957484) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is (2R)-2-[2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 56957484 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (2R)-2-[2-[(1S,2S,6R,8aR)-2,6-dimethyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2,3-dihydropyran-6-one |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3CC=CC(=O)O3)[C@H]2CC1 |
| InChI | InChI=1S/C19H26O2/c1-13-6-10-18-15(12-13)8-7-14(2)17(18)11-9-16-4-3-5-19(20)21-16/h3,5,7-8,12-14,16-18H,4,6,9-11H2,1-2H3/t13-,14+,16+,17+,18+/m1/s1 |
| InChIKey | XSCVDBFFRYSNDD-SRIISGBFSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |