C22H20N6O2+2 — CID 56957499
2-N,7-N-bis(1-methylpyridin-1-ium-3-yl)-1,8-naphthyridine-2,7-dicarboxamide (PubChem CID 56957499) has the molecular formula C22H20N6O2+2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-N,7-N-bis(1-methylpyridin-1-ium-3-yl)-1,8-naphthyridine-2,7-dicarboxamide.
| Compound Name | 2-N,7-N-bis(1-methylpyridin-1-ium-3-yl)-1,8-naphthyridine-2,7-dicarboxamide |
|---|---|
| PubChem CID | 56957499 |
| Molecular Formula | C22H20N6O2+2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 2-N,7-N-bis(1-methylpyridin-1-ium-3-yl)-1,8-naphthyridine-2,7-dicarboxamide |
| SMILES | C[n+]1cccc(NC(=O)c2ccc3ccc(C(=O)Nc4ccc[n+](C)c4)nc3n2)c1 |
| InChI | InChI=1S/C22H18N6O2/c1-27-11-3-5-16(13-27)23-21(29)18-9-7-15-8-10-19(26-20(15)25-18)22(30)24-17-6-4-12-28(2)14-17/h3-14H,1-2H3/p+2 |
| InChIKey | RDLNQSOEZCQOMR-UHFFFAOYSA-P |
| XLogP | 1.78 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|