C22H44O3Si — CID 56957601
ethyl (E,4R,8S)-4,8-dimethyl-9-tri(propan-2-yl)silyloxynon-2-enoate (PubChem CID 56957601) has the molecular formula C22H44O3Si and a molecular weight of 384.68 g/mol. Its IUPAC name is ethyl (E,4R,8S)-4,8-dimethyl-9-tri(propan-2-yl)silyloxynon-2-enoate.
| Compound Name | ethyl (E,4R,8S)-4,8-dimethyl-9-tri(propan-2-yl)silyloxynon-2-enoate |
|---|---|
| PubChem CID | 56957601 |
| Molecular Formula | C22H44O3Si |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | ethyl (E,4R,8S)-4,8-dimethyl-9-tri(propan-2-yl)silyloxynon-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C)CCC[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H44O3Si/c1-10-24-22(23)15-14-20(8)12-11-13-21(9)16-25-26(17(2)3,18(4)5)19(6)7/h14-15,17-21H,10-13,16H2,1-9H3/b15-14+/t20-,21+/m1/s1 |
| InChIKey | XUKJVJBZDHZHML-RMLDSDBCSA-N |
| XLogP | 6.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|