C24H22O6 — CID 56957808
3-O-[3,4-bis(phenylmethoxy)phenyl] 1-O-methyl propanedioate (PubChem CID 56957808) has the molecular formula C24H22O6 and a molecular weight of 406.43 g/mol. Its IUPAC name is 3-O-[3,4-bis(phenylmethoxy)phenyl] 1-O-methyl propanedioate.
| Compound Name | 3-O-[3,4-bis(phenylmethoxy)phenyl] 1-O-methyl propanedioate |
|---|---|
| PubChem CID | 56957808 |
| Molecular Formula | C24H22O6 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-O-[3,4-bis(phenylmethoxy)phenyl] 1-O-methyl propanedioate |
| SMILES | COC(=O)CC(=O)Oc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H22O6/c1-27-23(25)15-24(26)30-20-12-13-21(28-16-18-8-4-2-5-9-18)22(14-20)29-17-19-10-6-3-7-11-19/h2-14H,15-17H2,1H3 |
| InChIKey | RTHZGCMJMMSASI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|