About 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid
1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 56957928) has the molecular formula C11H10F6N2O3
and a molecular weight of 332.20 g/mol. Its IUPAC name is 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid |
| PubChem CID | 56957928 |
| Molecular Formula | C11H10F6N2O3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1c(C(F)(F)F)nn(C2CCCCO2)c1C(F)(F)F |
| InChI | InChI=1S/C11H10F6N2O3/c12-10(13,14)7-6(9(20)21)8(11(15,16)17)19(18-7)5-3-1-2-4-22-5/h5H,1-4H2,(H,20,21) |
| InChIKey | KQRDAQORCZXAJE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid?
The IUPAC name of 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid (CID 56957928) is 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid is O=C(O)c1c(C(F)(F)F)nn(C2CCCCO2)c1C(F)(F)F.
What is the InChIKey of 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid?
The InChIKey is KQRDAQORCZXAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F6N2O3/c12-10(13,14)7-6(9(20)21)8(11(15,16)17)19(18-7)5-3-1-2-4-22-5/h5H,1-4H2,(H,20,21).
What are the key properties of 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid?
1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid has a molecular weight of 332.20 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-2-yl)-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 56957928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).