C21H29NO4 — CID 56958277
tert-butyl N-[(1R)-1-[(4R)-2-phenyl-1,3-dioxolan-4-yl]but-3-enyl]-N-prop-2-enylcarbamate (PubChem CID 56958277) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[(4R)-2-phenyl-1,3-dioxolan-4-yl]but-3-enyl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[(1R)-1-[(4R)-2-phenyl-1,3-dioxolan-4-yl]but-3-enyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 56958277 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | tert-butyl N-[(1R)-1-[(4R)-2-phenyl-1,3-dioxolan-4-yl]but-3-enyl]-N-prop-2-enylcarbamate |
| SMILES | C=CC[C@H]([C@@H]1COC(c2ccccc2)O1)N(CC=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H29NO4/c1-6-11-17(22(14-7-2)20(23)26-21(3,4)5)18-15-24-19(25-18)16-12-9-8-10-13-16/h6-10,12-13,17-19H,1-2,11,14-15H2,3-5H3/t17-,18+,19?/m1/s1 |
| InChIKey | UAYKCLJLEYTPJR-YTYFACEESA-N |
| XLogP | 4.47 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|