C31H45NO6Si — CID 56958544
(2Z,4Z)-N-[(Z)-3-[(1S,11S,13S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-9-oxo-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-11-yl]prop-1-enyl]hepta-2,4-dienamide (PubChem CID 56958544) has the molecular formula C31H45NO6Si and a molecular weight of 555.79 g/mol. Its IUPAC name is (2Z,4Z)-N-[(Z)-3-[(1S,11S,13S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-9-oxo-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-11-yl]prop-1-enyl]hepta-2,4-dienamide.
| Compound Name | (2Z,4Z)-N-[(Z)-3-[(1S,11S,13S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-9-oxo-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-11-yl]prop-1-enyl]hepta-2,4-dienamide |
|---|---|
| PubChem CID | 56958544 |
| Molecular Formula | C31H45NO6Si |
| Molecular Weight | 555.79 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | (2Z,4Z)-N-[(Z)-3-[(1S,11S,13S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-9-oxo-10,17-dioxatricyclo[11.3.1.03,8]heptadeca-3(8),4,6-trien-11-yl]prop-1-enyl]hepta-2,4-dienamide |
| SMILES | CC/C=C\C=C/C(=O)N/C=C\C[C@H]1C[C@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](Cc3cccc(O)c3C(=O)O1)O2 |
| InChI | InChI=1S/C31H45NO6Si/c1-7-8-9-10-16-28(34)32-17-12-14-23-19-25-21-26(38-39(5,6)31(2,3)4)20-24(36-25)18-22-13-11-15-27(33)29(22)30(35)37-23/h8-13,15-17,23-26,33H,7,14,18-21H2,1-6H3,(H,32,34)/b9-8-,16-10-,17-12-/t23-,24-,25-,26-/m0/s1 |
| InChIKey | RLHNYVIUGUNBSR-KEEDVZLPSA-N |
| XLogP | 6.34 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.79 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|