C29H32O5 — CID 56958789
(5S)-5-[(4-methoxyphenyl)methoxy]-7-(3-methoxy-4-phenylmethoxyphenyl)hept-1-en-3-one (PubChem CID 56958789) has the molecular formula C29H32O5 and a molecular weight of 460.57 g/mol. Its IUPAC name is (5S)-5-[(4-methoxyphenyl)methoxy]-7-(3-methoxy-4-phenylmethoxyphenyl)hept-1-en-3-one.
| Compound Name | (5S)-5-[(4-methoxyphenyl)methoxy]-7-(3-methoxy-4-phenylmethoxyphenyl)hept-1-en-3-one |
|---|---|
| PubChem CID | 56958789 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (5S)-5-[(4-methoxyphenyl)methoxy]-7-(3-methoxy-4-phenylmethoxyphenyl)hept-1-en-3-one |
| SMILES | C=CC(=O)C[C@H](CCc1ccc(OCc2ccccc2)c(OC)c1)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H32O5/c1-4-25(30)19-27(33-20-24-11-14-26(31-2)15-12-24)16-10-22-13-17-28(29(18-22)32-3)34-21-23-8-6-5-7-9-23/h4-9,11-15,17-18,27H,1,10,16,19-21H2,2-3H3/t27-/m0/s1 |
| InChIKey | JRGOYSSAYYXWIF-MHZLTWQESA-N |
| XLogP | 5.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|