C16H23NO5 — CID 56958833
ethyl (4S,5R)-5-(hydroxymethyl)-3-nitro-4-phenylheptanoate (PubChem CID 56958833) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is ethyl (4S,5R)-5-(hydroxymethyl)-3-nitro-4-phenylheptanoate.
| Compound Name | ethyl (4S,5R)-5-(hydroxymethyl)-3-nitro-4-phenylheptanoate |
|---|---|
| PubChem CID | 56958833 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | ethyl (4S,5R)-5-(hydroxymethyl)-3-nitro-4-phenylheptanoate |
| SMILES | CCOC(=O)CC([C@H](c1ccccc1)C(CC)CO)[N+](=O)[O-] |
| InChI | InChI=1S/C16H23NO5/c1-3-12(11-18)16(13-8-6-5-7-9-13)14(17(20)21)10-15(19)22-4-2/h5-9,12,14,16,18H,3-4,10-11H2,1-2H3/t12?,14?,16-/m0/s1 |
| InChIKey | IRLDKLSYEWHVJJ-PXCJXSSVSA-N |
| XLogP | 2.39 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|