C42H52N2Si2 — CID 56958857
tri(propan-2-yl)-[2-[4-[2-[3-[2-[3-[2-tri(propan-2-yl)silylethynyl]-4-pyridinyl]ethynyl]phenyl]ethynyl]-3-pyridinyl]ethynyl]silane (PubChem CID 56958857) has the molecular formula C42H52N2Si2 and a molecular weight of 641.06 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[4-[2-[3-[2-[3-[2-tri(propan-2-yl)silylethynyl]-4-pyridinyl]ethynyl]phenyl]ethynyl]-3-pyridinyl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[4-[2-[3-[2-[3-[2-tri(propan-2-yl)silylethynyl]-4-pyridinyl]ethynyl]phenyl]ethynyl]-3-pyridinyl]ethynyl]silane |
|---|---|
| PubChem CID | 56958857 |
| Molecular Formula | C42H52N2Si2 |
| Molecular Weight | 641.06 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | tri(propan-2-yl)-[2-[4-[2-[3-[2-[3-[2-tri(propan-2-yl)silylethynyl]-4-pyridinyl]ethynyl]phenyl]ethynyl]-3-pyridinyl]ethynyl]silane |
| SMILES | CC(C)[Si](C#Cc1cnccc1C#Cc1cccc(C#Cc2ccncc2C#C[Si](C(C)C)(C(C)C)C(C)C)c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H52N2Si2/c1-31(2)45(32(3)4,33(5)6)26-22-41-29-43-24-20-39(41)18-16-37-14-13-15-38(28-37)17-19-40-21-25-44-30-42(40)23-27-46(34(7)8,35(9)10)36(11)12/h13-15,20-21,24-25,28-36H,1-12H3 |
| InChIKey | TZOABHYRSFWCCI-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.06 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|