C24H24O — CID 56958918
(4R,4aR,10bS)-9-methyl-4-naphthalen-2-yl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene (PubChem CID 56958918) has the molecular formula C24H24O and a molecular weight of 328.46 g/mol. Its IUPAC name is (4R,4aR,10bS)-9-methyl-4-naphthalen-2-yl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene.
| Compound Name | (4R,4aR,10bS)-9-methyl-4-naphthalen-2-yl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene |
|---|---|
| PubChem CID | 56958918 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (4R,4aR,10bS)-9-methyl-4-naphthalen-2-yl-2,4,4a,5,6,10b-hexahydro-1H-benzo[f]isochromene |
| SMILES | Cc1ccc2c(c1)[C@H]1CCO[C@@H](c3ccc4ccccc4c3)[C@@H]1CC2 |
| InChI | InChI=1S/C24H24O/c1-16-6-7-18-10-11-22-21(23(18)14-16)12-13-25-24(22)20-9-8-17-4-2-3-5-19(17)15-20/h2-9,14-15,21-22,24H,10-13H2,1H3/t21-,22+,24-/m0/s1 |
| InChIKey | ZTBGJYRDNVFNGO-ZDXQCDESSA-N |
| XLogP | 5.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |