C16H27BrO4 — CID 56959019
(3aR,5S,6R,8S,10aS)-5-bromo-6-ethyl-8-pentyl-3a,4,5,6,8,9,10,10a-octahydro-[1,3]dioxolo[4,5-e]oxonin-2-one (PubChem CID 56959019) has the molecular formula C16H27BrO4 and a molecular weight of 363.29 g/mol. Its IUPAC name is (3aR,5S,6R,8S,10aS)-5-bromo-6-ethyl-8-pentyl-3a,4,5,6,8,9,10,10a-octahydro-[1,3]dioxolo[4,5-e]oxonin-2-one.
| Compound Name | (3aR,5S,6R,8S,10aS)-5-bromo-6-ethyl-8-pentyl-3a,4,5,6,8,9,10,10a-octahydro-[1,3]dioxolo[4,5-e]oxonin-2-one |
|---|---|
| PubChem CID | 56959019 |
| Molecular Formula | C16H27BrO4 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (3aR,5S,6R,8S,10aS)-5-bromo-6-ethyl-8-pentyl-3a,4,5,6,8,9,10,10a-octahydro-[1,3]dioxolo[4,5-e]oxonin-2-one |
| SMILES | CCCCC[C@H]1CC[C@@H]2OC(=O)O[C@@H]2C[C@H](Br)[C@@H](CC)O1 |
| InChI | InChI=1S/C16H27BrO4/c1-3-5-6-7-11-8-9-14-15(21-16(18)20-14)10-12(17)13(4-2)19-11/h11-15H,3-10H2,1-2H3/t11-,12-,13+,14-,15+/m0/s1 |
| InChIKey | XKATUQGFZJOYNC-SBJFKYEJSA-N |
| XLogP | 4.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|