C13H21BrO4 — CID 56959021
(3aS,5S,7S,10aR)-7-[(1S)-1-bromopropyl]-5-methyl-3a,4,5,7,8,9,10,10a-octahydro-[1,3]dioxolo[4,5-d]oxonin-2-one (PubChem CID 56959021) has the molecular formula C13H21BrO4 and a molecular weight of 321.21 g/mol. Its IUPAC name is (3aS,5S,7S,10aR)-7-[(1S)-1-bromopropyl]-5-methyl-3a,4,5,7,8,9,10,10a-octahydro-[1,3]dioxolo[4,5-d]oxonin-2-one.
| Compound Name | (3aS,5S,7S,10aR)-7-[(1S)-1-bromopropyl]-5-methyl-3a,4,5,7,8,9,10,10a-octahydro-[1,3]dioxolo[4,5-d]oxonin-2-one |
|---|---|
| PubChem CID | 56959021 |
| Molecular Formula | C13H21BrO4 |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (3aS,5S,7S,10aR)-7-[(1S)-1-bromopropyl]-5-methyl-3a,4,5,7,8,9,10,10a-octahydro-[1,3]dioxolo[4,5-d]oxonin-2-one |
| SMILES | CC[C@H](Br)[C@@H]1CCC[C@H]2OC(=O)O[C@H]2C[C@H](C)O1 |
| InChI | InChI=1S/C13H21BrO4/c1-3-9(14)10-5-4-6-11-12(7-8(2)16-10)18-13(15)17-11/h8-12H,3-7H2,1-2H3/t8-,9-,10-,11+,12-/m0/s1 |
| InChIKey | AFMRJUKGBFXKKA-NGDQXYMTSA-N |
| XLogP | 3.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|