C24H23Cl2F3N4O — CID 56959085
1-(cyclopropylmethyl)-3-[(E)-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]-2-methylphenyl]methylideneamino]urea (PubChem CID 56959085) has the molecular formula C24H23Cl2F3N4O and a molecular weight of 511.38 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-[(E)-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]-2-methylphenyl]methylideneamino]urea.
| Compound Name | 1-(cyclopropylmethyl)-3-[(E)-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]-2-methylphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 56959085 |
| Molecular Formula | C24H23Cl2F3N4O |
| Molecular Weight | 511.38 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-[(E)-[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]-2-methylphenyl]methylideneamino]urea |
| SMILES | Cc1cc(C2=NCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1/C=N/NC(=O)NCC1CC1 |
| InChI | InChI=1S/C24H23Cl2F3N4O/c1-14-6-16(4-5-17(14)12-32-33-22(34)30-11-15-2-3-15)21-10-23(13-31-21,24(27,28)29)18-7-19(25)9-20(26)8-18/h4-9,12,15H,2-3,10-11,13H2,1H3,(H2,30,33,34)/b32-12+ |
| InChIKey | JKSMGWWLKGIDBX-DPWJMMOYSA-N |
| XLogP | 6.04 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.38 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|