C28H23ClFN3O4 — CID 56959420
5-[7-[5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]pentanoic acid (PubChem CID 56959420) has the molecular formula C28H23ClFN3O4 and a molecular weight of 519.96 g/mol. Its IUPAC name is 5-[7-[5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]pentanoic acid.
| Compound Name | 5-[7-[5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 56959420 |
| Molecular Formula | C28H23ClFN3O4 |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | 5-[7-[5-(3-chlorophenyl)-4,5-dihydro-1,2-oxazol-3-yl]-3-(4-fluorophenyl)-4-oxoquinazolin-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nc2cc(C3=NOC(c4cccc(Cl)c4)C3)ccc2c(=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C28H23ClFN3O4/c29-19-5-3-4-18(14-19)25-16-23(32-37-25)17-8-13-22-24(15-17)31-26(6-1-2-7-27(34)35)33(28(22)36)21-11-9-20(30)10-12-21/h3-5,8-15,25H,1-2,6-7,16H2,(H,34,35) |
| InChIKey | HBXYDTSXLGKVOY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|