C20H36O4 — CID 56959454
tert-butyl [(2S,3S,6S)-2-[(E)-pent-2-enyl]-6-pentyloxan-3-yl] carbonate (PubChem CID 56959454) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is tert-butyl [(2S,3S,6S)-2-[(E)-pent-2-enyl]-6-pentyloxan-3-yl] carbonate.
| Compound Name | tert-butyl [(2S,3S,6S)-2-[(E)-pent-2-enyl]-6-pentyloxan-3-yl] carbonate |
|---|---|
| PubChem CID | 56959454 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | tert-butyl [(2S,3S,6S)-2-[(E)-pent-2-enyl]-6-pentyloxan-3-yl] carbonate |
| SMILES | CC/C=C/C[C@@H]1O[C@@H](CCCCC)CC[C@@H]1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H36O4/c1-6-8-10-12-16-14-15-18(17(22-16)13-11-9-7-2)23-19(21)24-20(3,4)5/h9,11,16-18H,6-8,10,12-15H2,1-5H3/b11-9+/t16-,17-,18-/m0/s1 |
| InChIKey | HVNURKXZNQLDKS-LCLOVIMFSA-N |
| XLogP | 5.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|