C19H24N4O4 — CID 56959517
(3S)-N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]-3-hydroxy-2-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 56959517) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is (3S)-N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]-3-hydroxy-2-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]-3-hydroxy-2-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 56959517 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (3S)-N-[2-(5-tert-butyl-1,2,4-oxadiazol-3-yl)ethyl]-3-hydroxy-2-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CC(C)(C)c1nc(CCNC(=O)[C@@]2(O)CCN(c3ccccc3)C2=O)no1 |
| InChI | InChI=1S/C19H24N4O4/c1-18(2,3)16-21-14(22-27-16)9-11-20-15(24)19(26)10-12-23(17(19)25)13-7-5-4-6-8-13/h4-8,26H,9-12H2,1-3H3,(H,20,24)/t19-/m0/s1 |
| InChIKey | GJQMUNNJDNGPPO-IBGZPJMESA-N |
| XLogP | 1.19 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|