C16H18N4O3S — CID 56959522
(3S)-3-hydroxy-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]-2-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 56959522) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is (3S)-3-hydroxy-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]-2-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-3-hydroxy-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]-2-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 56959522 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (3S)-3-hydroxy-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]-2-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | Cc1nnc(CCNC(=O)[C@@]2(O)CCN(c3ccccc3)C2=O)s1 |
| InChI | InChI=1S/C16H18N4O3S/c1-11-18-19-13(24-11)7-9-17-14(21)16(23)8-10-20(15(16)22)12-5-3-2-4-6-12/h2-6,23H,7-10H2,1H3,(H,17,21)/t16-/m0/s1 |
| InChIKey | JUGMWZYMIMVYPS-INIZCTEOSA-N |
| XLogP | 0.67 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|