C24H20N4O6S — CID 56959578
2-(4-benzamidophenyl)sulfonyl-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoic acid (PubChem CID 56959578) has the molecular formula C24H20N4O6S and a molecular weight of 492.51 g/mol. Its IUPAC name is 2-(4-benzamidophenyl)sulfonyl-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoic acid.
| Compound Name | 2-(4-benzamidophenyl)sulfonyl-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoic acid |
|---|---|
| PubChem CID | 56959578 |
| Molecular Formula | C24H20N4O6S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 2-(4-benzamidophenyl)sulfonyl-4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoic acid |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C(CCn2nnc3ccccc3c2=O)C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N4O6S/c29-22(16-6-2-1-3-7-16)25-17-10-12-18(13-11-17)35(33,34)21(24(31)32)14-15-28-23(30)19-8-4-5-9-20(19)26-27-28/h1-13,21H,14-15H2,(H,25,29)(H,31,32) |
| InChIKey | PUUPFMUQFLGZPK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 148.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |