About N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine
N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 56959622) has the molecular formula C24H23FN4O
and a molecular weight of 402.47 g/mol. Its IUPAC name is N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine |
| PubChem CID | 56959622 |
| Molecular Formula | C24H23FN4O |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNc1nc(-c2ccc(Oc3ccc(F)cc3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C24H23FN4O/c1-29(2)16-15-26-24-27-22-6-4-3-5-21(22)23(28-24)17-7-11-19(12-8-17)30-20-13-9-18(25)10-14-20/h3-14H,15-16H2,1-2H3,(H,26,27,28) |
| InChIKey | JWSPPXVZTUCCFG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine?
The IUPAC name of N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine (CID 56959622) is N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine?
The canonical SMILES for N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine is CN(C)CCNc1nc(-c2ccc(Oc3ccc(F)cc3)cc2)c2ccccc2n1.
What is the InChIKey of N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine?
The InChIKey is JWSPPXVZTUCCFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23FN4O/c1-29(2)16-15-26-24-27-22-6-4-3-5-21(22)23(28-24)17-7-11-19(12-8-17)30-20-13-9-18(25)10-14-20/h3-14H,15-16H2,1-2H3,(H,26,27,28).
What are the key properties of N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine?
N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine has a molecular weight of 402.47 g/mol, XLogP of 5.20, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]-N',N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 56959622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).