C17H27N — CID 56960045
2-octan-2-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 56960045) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 2-octan-2-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 2-octan-2-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 56960045 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 2-octan-2-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCCCCC(C)C1CCc2ccccc2N1 |
| InChI | InChI=1S/C17H27N/c1-3-4-5-6-9-14(2)16-13-12-15-10-7-8-11-17(15)18-16/h7-8,10-11,14,16,18H,3-6,9,12-13H2,1-2H3 |
| InChIKey | STTNCZPAYVBPKP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|