C27H24N4O6S — CID 56960234
benzyl 4-[6-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]pyrimidin-4-yl]oxypiperidine-1-carboxylate (PubChem CID 56960234) has the molecular formula C27H24N4O6S and a molecular weight of 532.58 g/mol. Its IUPAC name is benzyl 4-[6-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]pyrimidin-4-yl]oxypiperidine-1-carboxylate.
| Compound Name | benzyl 4-[6-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]pyrimidin-4-yl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 56960234 |
| Molecular Formula | C27H24N4O6S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | benzyl 4-[6-[3-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]pyrimidin-4-yl]oxypiperidine-1-carboxylate |
| SMILES | O=C1NC(=O)/C(=C/c2cccc(Oc3cc(OC4CCN(C(=O)OCc5ccccc5)CC4)ncn3)c2)S1 |
| InChI | InChI=1S/C27H24N4O6S/c32-25-22(38-26(33)30-25)14-19-7-4-8-21(13-19)37-24-15-23(28-17-29-24)36-20-9-11-31(12-10-20)27(34)35-16-18-5-2-1-3-6-18/h1-8,13-15,17,20H,9-12,16H2,(H,30,32,33)/b22-14- |
| InChIKey | BCGLDHYFBLGDSL-HMAPJEAMSA-N |
| XLogP | 4.77 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|