C21H24FN7O — CID 56960500
4-[4-[(2-fluoroethylamino)methyl]piperidin-1-yl]-N-(1H-indazol-6-yl)furo[3,2-d]pyrimidin-2-amine (PubChem CID 56960500) has the molecular formula C21H24FN7O and a molecular weight of 409.47 g/mol. Its IUPAC name is 4-[4-[(2-fluoroethylamino)methyl]piperidin-1-yl]-N-(1H-indazol-6-yl)furo[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-[4-[(2-fluoroethylamino)methyl]piperidin-1-yl]-N-(1H-indazol-6-yl)furo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 56960500 |
| Molecular Formula | C21H24FN7O |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 4-[4-[(2-fluoroethylamino)methyl]piperidin-1-yl]-N-(1H-indazol-6-yl)furo[3,2-d]pyrimidin-2-amine |
| SMILES | FCCNCC1CCN(c2nc(Nc3ccc4cn[nH]c4c3)nc3ccoc23)CC1 |
| InChI | InChI=1S/C21H24FN7O/c22-6-7-23-12-14-3-8-29(9-4-14)20-19-17(5-10-30-19)26-21(27-20)25-16-2-1-15-13-24-28-18(15)11-16/h1-2,5,10-11,13-14,23H,3-4,6-9,12H2,(H,24,28)(H,25,26,27) |
| InChIKey | LBNMMNCCKPDQCE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|